C15H15N3O7S — CID 20687264
[2-(6-acetamido-3-pyridinyl)-2-hydroxyethyl] (4-nitrophenyl) sulfite (PubChem CID 20687264) has the molecular formula C15H15N3O7S and a molecular weight of 381.37 g/mol. Its IUPAC name is [2-(6-acetamido-3-pyridinyl)-2-hydroxyethyl] (4-nitrophenyl) sulfite.
| Compound Name | [2-(6-acetamido-3-pyridinyl)-2-hydroxyethyl] (4-nitrophenyl) sulfite |
|---|---|
| PubChem CID | 20687264 |
| Molecular Formula | C15H15N3O7S |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | [2-(6-acetamido-3-pyridinyl)-2-hydroxyethyl] (4-nitrophenyl) sulfite |
| SMILES | CC(=O)Nc1ccc(C(O)COS(=O)Oc2ccc([N+](=O)[O-])cc2)cn1 |
| InChI | InChI=1S/C15H15N3O7S/c1-10(19)17-15-7-2-11(8-16-15)14(20)9-24-26(23)25-13-5-3-12(4-6-13)18(21)22/h2-8,14,20H,9H2,1H3,(H,16,17,19) |
| InChIKey | ZJBZDENJJSZELQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 140.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|