C48H56O4P2S — CID 20688081
(2,4-ditert-butylphenoxy)-[1-[2-(2,4-ditert-butylphenoxy)phosphanyloxynaphthalen-1-yl]sulfanylnaphthalen-2-yl]oxyphosphane (PubChem CID 20688081) has the molecular formula C48H56O4P2S and a molecular weight of 790.99 g/mol. Its IUPAC name is (2,4-ditert-butylphenoxy)-[1-[2-(2,4-ditert-butylphenoxy)phosphanyloxynaphthalen-1-yl]sulfanylnaphthalen-2-yl]oxyphosphane.
| Compound Name | (2,4-ditert-butylphenoxy)-[1-[2-(2,4-ditert-butylphenoxy)phosphanyloxynaphthalen-1-yl]sulfanylnaphthalen-2-yl]oxyphosphane |
|---|---|
| PubChem CID | 20688081 |
| Molecular Formula | C48H56O4P2S |
| Molecular Weight | 790.99 g/mol |
| Exact Mass | 790.34 |
| IUPAC Name | (2,4-ditert-butylphenoxy)-[1-[2-(2,4-ditert-butylphenoxy)phosphanyloxynaphthalen-1-yl]sulfanylnaphthalen-2-yl]oxyphosphane |
| SMILES | CC(C)(C)c1ccc(OPOc2ccc3ccccc3c2Sc2c(OPOc3ccc(C(C)(C)C)cc3C(C)(C)C)ccc3ccccc23)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C48H56O4P2S/c1-45(2,3)33-23-27-39(37(29-33)47(7,8)9)49-53-51-41-25-21-31-17-13-15-19-35(31)43(41)55-44-36-20-16-14-18-32(36)22-26-42(44)52-54-50-40-28-24-34(46(4,5)6)30-38(40)48(10,11)12/h13-30,53-54H,1-12H3 |
| InChIKey | VRQMQKOSZJMWAV-UHFFFAOYSA-N |
| XLogP | 15.27 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.99 |
| LogP ≤ 5 | 15.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|