C29H36N6O6 — CID 20691593
3-[2-(2-hydroxyethoxy)-4,8-bis[(4-methoxyphenyl)methyl-methylamino]pyrimido[5,4-d]pyrimidin-6-yl]oxypropan-1-ol (PubChem CID 20691593) has the molecular formula C29H36N6O6 and a molecular weight of 564.64 g/mol. Its IUPAC name is 3-[2-(2-hydroxyethoxy)-4,8-bis[(4-methoxyphenyl)methyl-methylamino]pyrimido[5,4-d]pyrimidin-6-yl]oxypropan-1-ol.
| Compound Name | 3-[2-(2-hydroxyethoxy)-4,8-bis[(4-methoxyphenyl)methyl-methylamino]pyrimido[5,4-d]pyrimidin-6-yl]oxypropan-1-ol |
|---|---|
| PubChem CID | 20691593 |
| Molecular Formula | C29H36N6O6 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | 3-[2-(2-hydroxyethoxy)-4,8-bis[(4-methoxyphenyl)methyl-methylamino]pyrimido[5,4-d]pyrimidin-6-yl]oxypropan-1-ol |
| SMILES | COc1ccc(CN(C)c2nc(OCCCO)nc3c(N(C)Cc4ccc(OC)cc4)nc(OCCO)nc23)cc1 |
| InChI | InChI=1S/C29H36N6O6/c1-34(18-20-6-10-22(38-3)11-7-20)26-25-24(30-28(32-26)40-16-5-14-36)27(33-29(31-25)41-17-15-37)35(2)19-21-8-12-23(39-4)13-9-21/h6-13,36-37H,5,14-19H2,1-4H3 |
| InChIKey | PPNPDMWXQPTQOB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 135.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|