C11H18F2 — CID 20692081
2,2-difluoro-5,7,7-trimethylspiro[2.5]octane (PubChem CID 20692081) has the molecular formula C11H18F2 and a molecular weight of 188.26 g/mol. Its IUPAC name is 2,2-difluoro-5,7,7-trimethylspiro[2.5]octane.
| Compound Name | 2,2-difluoro-5,7,7-trimethylspiro[2.5]octane |
|---|---|
| PubChem CID | 20692081 |
| Molecular Formula | C11H18F2 |
| Molecular Weight | 188.26 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | 2,2-difluoro-5,7,7-trimethylspiro[2.5]octane |
| SMILES | CC1CC(C)(C)CC2(C1)CC2(F)F |
| InChI | InChI=1S/C11H18F2/c1-8-4-9(2,3)6-10(5-8)7-11(10,12)13/h8H,4-7H2,1-3H3 |
| InChIKey | YPABCBBJGQEILC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.26 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |