C18H28N2O — CID 20692217
3,3,5-trimethyl-5-[(E)-C-methyl-N-phenylmethoxycarbonimidoyl]cyclohexan-1-amine (PubChem CID 20692217) has the molecular formula C18H28N2O and a molecular weight of 288.43 g/mol. Its IUPAC name is 3,3,5-trimethyl-5-[(E)-C-methyl-N-phenylmethoxycarbonimidoyl]cyclohexan-1-amine.
| Compound Name | 3,3,5-trimethyl-5-[(E)-C-methyl-N-phenylmethoxycarbonimidoyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 20692217 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 3,3,5-trimethyl-5-[(E)-C-methyl-N-phenylmethoxycarbonimidoyl]cyclohexan-1-amine |
| SMILES | C/C(=N\OCc1ccccc1)C1(C)CC(N)CC(C)(C)C1 |
| InChI | InChI=1S/C18H28N2O/c1-14(20-21-12-15-8-6-5-7-9-15)18(4)11-16(19)10-17(2,3)13-18/h5-9,16H,10-13,19H2,1-4H3/b20-14+ |
| InChIKey | MAZUPPWERYRHMH-XSFVSMFZSA-N |
| XLogP | 4.12 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|