C44H62N6O4S2 — CID 20693782
2-[3,5-bis[[2-methyl-5-(2,4,4-trimethylpentan-2-yl)phenoxy]sulfinylamino]phenyl]-6-tert-butyl-5H-pyrazolo[1,5-b][1,2,4]triazole (PubChem CID 20693782) has the molecular formula C44H62N6O4S2 and a molecular weight of 803.15 g/mol. Its IUPAC name is 2-[3,5-bis[[2-methyl-5-(2,4,4-trimethylpentan-2-yl)phenoxy]sulfinylamino]phenyl]-6-tert-butyl-5H-pyrazolo[1,5-b][1,2,4]triazole.
| Compound Name | 2-[3,5-bis[[2-methyl-5-(2,4,4-trimethylpentan-2-yl)phenoxy]sulfinylamino]phenyl]-6-tert-butyl-5H-pyrazolo[1,5-b][1,2,4]triazole |
|---|---|
| PubChem CID | 20693782 |
| Molecular Formula | C44H62N6O4S2 |
| Molecular Weight | 803.15 g/mol |
| Exact Mass | 802.43 |
| IUPAC Name | 2-[3,5-bis[[2-methyl-5-(2,4,4-trimethylpentan-2-yl)phenoxy]sulfinylamino]phenyl]-6-tert-butyl-5H-pyrazolo[1,5-b][1,2,4]triazole |
| SMILES | Cc1ccc(C(C)(C)CC(C)(C)C)cc1OS(=O)Nc1cc(NS(=O)Oc2cc(C(C)(C)CC(C)(C)C)ccc2C)cc(-c2nc3cc(C(C)(C)C)[nH]n3n2)c1 |
| InChI | InChI=1S/C44H62N6O4S2/c1-28-16-18-31(43(12,13)26-40(3,4)5)22-35(28)53-55(51)48-33-20-30(39-45-38-25-37(42(9,10)11)46-50(38)47-39)21-34(24-33)49-56(52)54-36-23-32(19-17-29(36)2)44(14,15)27-41(6,7)8/h16-25,46,48-49H,26-27H2,1-15H3 |
| InChIKey | HELAIBTYHSTGBP-UHFFFAOYSA-N |
| XLogP | 11.21 |
| TPSA | 122.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.15 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |