C49H80N6O2 — CID 23558569
3-[[2-(6-tert-butyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)propylamino]methyl]-4-octoxy-N-[[2-octoxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]methyl]aniline (PubChem CID 23558569) has the molecular formula C49H80N6O2 and a molecular weight of 785.22 g/mol. Its IUPAC name is 3-[[2-(6-tert-butyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)propylamino]methyl]-4-octoxy-N-[[2-octoxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]methyl]aniline.
| Compound Name | 3-[[2-(6-tert-butyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)propylamino]methyl]-4-octoxy-N-[[2-octoxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 23558569 |
| Molecular Formula | C49H80N6O2 |
| Molecular Weight | 785.22 g/mol |
| Exact Mass | 784.63 |
| IUPAC Name | 3-[[2-(6-tert-butyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)propylamino]methyl]-4-octoxy-N-[[2-octoxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]methyl]aniline |
| SMILES | CCCCCCCCOc1ccc(NCc2cc(C(C)(C)CC(C)(C)C)ccc2OCCCCCCCC)cc1CNCC(C)c1nc2cc(C(C)(C)C)[nH]n2n1 |
| InChI | InChI=1S/C49H80N6O2/c1-12-14-16-18-20-22-28-56-42-26-24-40(49(10,11)36-47(4,5)6)30-38(42)35-51-41-25-27-43(57-29-23-21-19-17-15-13-2)39(31-41)34-50-33-37(3)46-52-45-32-44(48(7,8)9)53-55(45)54-46/h24-27,30-32,37,50-51,53H,12-23,28-29,33-36H2,1-11H3 |
| InChIKey | STKLXNOILGTXQK-UHFFFAOYSA-N |
| XLogP | 13.05 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.22 |
| LogP ≤ 5 | 13.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|