C17H32 — CID 20695172
(5E)-2,3,3,4,5,6,8-heptamethyldeca-1,5-diene (PubChem CID 20695172) has the molecular formula C17H32 and a molecular weight of 236.44 g/mol. Its IUPAC name is (5E)-2,3,3,4,5,6,8-heptamethyldeca-1,5-diene.
| Compound Name | (5E)-2,3,3,4,5,6,8-heptamethyldeca-1,5-diene |
|---|---|
| PubChem CID | 20695172 |
| Molecular Formula | C17H32 |
| Molecular Weight | 236.44 g/mol |
| Exact Mass | 236.25 |
| IUPAC Name | (5E)-2,3,3,4,5,6,8-heptamethyldeca-1,5-diene |
| SMILES | C=C(C)C(C)(C)C(C)/C(C)=C(\C)CC(C)CC |
| InChI | InChI=1S/C17H32/c1-10-13(4)11-14(5)15(6)16(7)17(8,9)12(2)3/h13,16H,2,10-11H2,1,3-9H3/b15-14+ |
| InChIKey | OXRZPNDBYKSKAJ-CCEZHUSRSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.44 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|