C14H28N+ — CID 123169756
(2-ethyl-2,5-dimethyl-3-methylideneheptyl)-methyl-methylideneazanium (PubChem CID 123169756) has the molecular formula C14H28N+ and a molecular weight of 210.38 g/mol. Its IUPAC name is (2-ethyl-2,5-dimethyl-3-methylideneheptyl)-methyl-methylideneazanium.
| Compound Name | (2-ethyl-2,5-dimethyl-3-methylideneheptyl)-methyl-methylideneazanium |
|---|---|
| PubChem CID | 123169756 |
| Molecular Formula | C14H28N+ |
| Molecular Weight | 210.38 g/mol |
| Exact Mass | 210.22 |
| IUPAC Name | (2-ethyl-2,5-dimethyl-3-methylideneheptyl)-methyl-methylideneazanium |
| SMILES | C=C(CC(C)CC)C(C)(CC)C[N+](=C)C |
| InChI | InChI=1S/C14H28N/c1-8-12(3)10-13(4)14(5,9-2)11-15(6)7/h12H,4,6,8-11H2,1-3,5,7H3/q+1 |
| InChIKey | SRNGWEWHCGVMAA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|