C26H30N4O2 — CID 20696178
N'-[1,1-bis[4-(dimethylamino)phenyl]-2-oxo-2-phenylethyl]acetohydrazide (PubChem CID 20696178) has the molecular formula C26H30N4O2 and a molecular weight of 430.55 g/mol. Its IUPAC name is N'-[1,1-bis[4-(dimethylamino)phenyl]-2-oxo-2-phenylethyl]acetohydrazide.
| Compound Name | N'-[1,1-bis[4-(dimethylamino)phenyl]-2-oxo-2-phenylethyl]acetohydrazide |
|---|---|
| PubChem CID | 20696178 |
| Molecular Formula | C26H30N4O2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | N'-[1,1-bis[4-(dimethylamino)phenyl]-2-oxo-2-phenylethyl]acetohydrazide |
| SMILES | CC(=O)NNC(C(=O)c1ccccc1)(c1ccc(N(C)C)cc1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C26H30N4O2/c1-19(31)27-28-26(25(32)20-9-7-6-8-10-20,21-11-15-23(16-12-21)29(2)3)22-13-17-24(18-14-22)30(4)5/h6-18,28H,1-5H3,(H,27,31) |
| InChIKey | IHRXKTHNSYGRLN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|