C10H11NO2 — CID 20698390
3-(3-methylphenyl)-5,6-dihydro-1,4,2-dioxazine (PubChem CID 20698390) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 3-(3-methylphenyl)-5,6-dihydro-1,4,2-dioxazine.
| Compound Name | 3-(3-methylphenyl)-5,6-dihydro-1,4,2-dioxazine |
|---|---|
| PubChem CID | 20698390 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 3-(3-methylphenyl)-5,6-dihydro-1,4,2-dioxazine |
| SMILES | Cc1cccc(C2=NOCCO2)c1 |
| InChI | InChI=1S/C10H11NO2/c1-8-3-2-4-9(7-8)10-11-13-6-5-12-10/h2-4,7H,5-6H2,1H3 |
| InChIKey | ISGALMQUONXWDW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |