C17H20N3O4S+ — CID 20698558
(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-3-(5,6,7-trimethylimidazo[5,1-b][1,3]thiazol-4-ium-2-yl)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 20698558) has the molecular formula C17H20N3O4S+ and a molecular weight of 362.43 g/mol. Its IUPAC name is (5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-3-(5,6,7-trimethylimidazo[5,1-b][1,3]thiazol-4-ium-2-yl)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-3-(5,6,7-trimethylimidazo[5,1-b][1,3]thiazol-4-ium-2-yl)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 20698558 |
| Molecular Formula | C17H20N3O4S+ |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | (5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-3-(5,6,7-trimethylimidazo[5,1-b][1,3]thiazol-4-ium-2-yl)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | Cc1c2sc(C3=C(C(=O)O)N4C(=O)[C@H]([C@@H](C)O)[C@H]4C3)c[n+]2c(C)n1C |
| InChI | InChI=1S/C17H19N3O4S/c1-7-16-19(9(3)18(7)4)6-12(25-16)10-5-11-13(8(2)21)15(22)20(11)14(10)17(23)24/h6,8,11,13,21H,5H2,1-4H3/p+1/t8-,11-,13-/m1/s1 |
| InChIKey | WWHJYIKUSPUNNL-XTWCZFFVSA-O |
| XLogP | 0.85 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|