C9H18N2OS2 — CID 20699047
1-[2-(hydroxymethyl)-4,4-dimethyl-1,3-thiazolidin-3-yl]-2-(methylamino)ethanethione (PubChem CID 20699047) has the molecular formula C9H18N2OS2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 1-[2-(hydroxymethyl)-4,4-dimethyl-1,3-thiazolidin-3-yl]-2-(methylamino)ethanethione.
| Compound Name | 1-[2-(hydroxymethyl)-4,4-dimethyl-1,3-thiazolidin-3-yl]-2-(methylamino)ethanethione |
|---|---|
| PubChem CID | 20699047 |
| Molecular Formula | C9H18N2OS2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 1-[2-(hydroxymethyl)-4,4-dimethyl-1,3-thiazolidin-3-yl]-2-(methylamino)ethanethione |
| SMILES | CNCC(=S)N1C(CO)SCC1(C)C |
| InChI | InChI=1S/C9H18N2OS2/c1-9(2)6-14-8(5-12)11(9)7(13)4-10-3/h8,10,12H,4-6H2,1-3H3 |
| InChIKey | JOUDVZNUQPQGLN-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|