About 1-[2-(hydroxymethyl)-1,3-thiazolidin-3-yl]-2-(methylamino)ethanethione
1-[2-(hydroxymethyl)-1,3-thiazolidin-3-yl]-2-(methylamino)ethanethione (PubChem CID 20699050) has the molecular formula C7H14N2OS2
and a molecular weight of 206.34 g/mol. Its IUPAC name is 1-[2-(hydroxymethyl)-1,3-thiazolidin-3-yl]-2-(methylamino)ethanethione.
Molecular Properties
| Compound Name | 1-[2-(hydroxymethyl)-1,3-thiazolidin-3-yl]-2-(methylamino)ethanethione |
| PubChem CID | 20699050 |
| Molecular Formula | C7H14N2OS2 |
| Molecular Weight | 206.34 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 1-[2-(hydroxymethyl)-1,3-thiazolidin-3-yl]-2-(methylamino)ethanethione |
| SMILES | CNCC(=S)N1CCSC1CO |
| InChI | InChI=1S/C7H14N2OS2/c1-8-4-6(11)9-2-3-12-7(9)5-10/h7-8,10H,2-5H2,1H3 |
| InChIKey | JXNHRXQFWDAESD-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.34 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(hydroxymethyl)-1,3-thiazolidin-3-yl]-2-(methylamino)ethanethione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(hydroxymethyl)-1,3-thiazolidin-3-yl]-2-(methylamino)ethanethione?
The IUPAC name of 1-[2-(hydroxymethyl)-1,3-thiazolidin-3-yl]-2-(methylamino)ethanethione (CID 20699050) is 1-[2-(hydroxymethyl)-1,3-thiazolidin-3-yl]-2-(methylamino)ethanethione.
What is the SMILES notation for 1-[2-(hydroxymethyl)-1,3-thiazolidin-3-yl]-2-(methylamino)ethanethione?
The canonical SMILES for 1-[2-(hydroxymethyl)-1,3-thiazolidin-3-yl]-2-(methylamino)ethanethione is CNCC(=S)N1CCSC1CO.
What is the InChIKey of 1-[2-(hydroxymethyl)-1,3-thiazolidin-3-yl]-2-(methylamino)ethanethione?
The InChIKey is JXNHRXQFWDAESD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2OS2/c1-8-4-6(11)9-2-3-12-7(9)5-10/h7-8,10H,2-5H2,1H3.
What are the key properties of 1-[2-(hydroxymethyl)-1,3-thiazolidin-3-yl]-2-(methylamino)ethanethione?
1-[2-(hydroxymethyl)-1,3-thiazolidin-3-yl]-2-(methylamino)ethanethione has a molecular weight of 206.34 g/mol, XLogP of -0.10, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(hydroxymethyl)-1,3-thiazolidin-3-yl]-2-(methylamino)ethanethione is sourced from PubChem (CID 20699050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).