C5H9N3 — CID 20699949
N,4-dimethyl-1H-pyrazol-5-amine (PubChem CID 20699949) has the molecular formula C5H9N3 and a molecular weight of 111.15 g/mol. Its IUPAC name is N,4-dimethyl-1H-pyrazol-5-amine.
| Compound Name | N,4-dimethyl-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 20699949 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | N,4-dimethyl-1H-pyrazol-5-amine |
| SMILES | CNc1[nH]ncc1C |
| InChI | InChI=1S/C5H9N3/c1-4-3-7-8-5(4)6-2/h3H,1-2H3,(H2,6,7,8) |
| InChIKey | IENYLMMZADXOEE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |