C14H8NO- — CID 20700877
N-dodeca-1,2,3,4,5,6,7,8,9,10-decaenylacetamide (PubChem CID 20700877) has the molecular formula C14H8NO- and a molecular weight of 206.22 g/mol. Its IUPAC name is N-dodeca-1,2,3,4,5,6,7,8,9,10-decaenylacetamide.
| Compound Name | N-dodeca-1,2,3,4,5,6,7,8,9,10-decaenylacetamide |
|---|---|
| PubChem CID | 20700877 |
| Molecular Formula | C14H8NO- |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | N-dodeca-1,2,3,4,5,6,7,8,9,10-decaenylacetamide |
| SMILES | C[C-]=C=C=C=C=C=C=C=C=C=CNC(C)=O |
| InChI | InChI=1S/C14H8NO/c1-3-4-5-6-7-8-9-10-11-12-13-15-14(2)16/h13H,1-2H3,(H,15,16)/q-1 |
| InChIKey | XEKYLTQJIKCPBI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|