C24H37N5O5S3 — CID 20701014
2-[[2-[3-(acetamidomethylsulfanyl)-2-[(2-amino-3-sulfanylpropyl)amino]propanoyl]-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 20701014) has the molecular formula C24H37N5O5S3 and a molecular weight of 571.79 g/mol. Its IUPAC name is 2-[[2-[3-(acetamidomethylsulfanyl)-2-[(2-amino-3-sulfanylpropyl)amino]propanoyl]-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-[3-(acetamidomethylsulfanyl)-2-[(2-amino-3-sulfanylpropyl)amino]propanoyl]-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 20701014 |
| Molecular Formula | C24H37N5O5S3 |
| Molecular Weight | 571.79 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | 2-[[2-[3-(acetamidomethylsulfanyl)-2-[(2-amino-3-sulfanylpropyl)amino]propanoyl]-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)C1Cc2ccccc2CN1C(=O)C(CSCNC(C)=O)NCC(N)CS)C(=O)O |
| InChI | InChI=1S/C24H37N5O5S3/c1-15(30)27-14-37-13-20(26-10-18(25)12-35)23(32)29-11-17-6-4-3-5-16(17)9-21(29)22(31)28-19(24(33)34)7-8-36-2/h3-6,18-21,26,35H,7-14,25H2,1-2H3,(H,27,30)(H,28,31)(H,33,34) |
| InChIKey | HEYWHAFSQZEZRQ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 153.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.79 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|