C23H34N4O4S3 — CID 59936288
(2S)-2-[[(3S)-2-[(4R,7R)-7-amino-3,3-dimethyl-1,2,5-dithiazocane-4-carbonyl]-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 59936288) has the molecular formula C23H34N4O4S3 and a molecular weight of 526.75 g/mol. Its IUPAC name is (2S)-2-[[(3S)-2-[(4R,7R)-7-amino-3,3-dimethyl-1,2,5-dithiazocane-4-carbonyl]-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[(3S)-2-[(4R,7R)-7-amino-3,3-dimethyl-1,2,5-dithiazocane-4-carbonyl]-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 59936288 |
| Molecular Formula | C23H34N4O4S3 |
| Molecular Weight | 526.75 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | (2S)-2-[[(3S)-2-[(4R,7R)-7-amino-3,3-dimethyl-1,2,5-dithiazocane-4-carbonyl]-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)[C@@H]1Cc2ccccc2CN1C(=O)[C@H]1NC[C@@H](N)CSSC1(C)C)C(=O)O |
| InChI | InChI=1S/C23H34N4O4S3/c1-23(2)19(25-11-16(24)13-33-34-23)21(29)27-12-15-7-5-4-6-14(15)10-18(27)20(28)26-17(22(30)31)8-9-32-3/h4-7,16-19,25H,8-13,24H2,1-3H3,(H,26,28)(H,30,31)/t16-,17+,18+,19-/m1/s1 |
| InChIKey | KRVAFWGTEPTYOO-YDZRNGNQSA-N |
| XLogP | 1.72 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.75 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|