C29H31F3N4O — CID 20701153
6-methoxy-8-[4-[4-[6-(trifluoromethyl)-1H-indol-3-yl]cyclohexyl]piperazin-1-yl]quinoline (PubChem CID 20701153) has the molecular formula C29H31F3N4O and a molecular weight of 508.59 g/mol. Its IUPAC name is 6-methoxy-8-[4-[4-[6-(trifluoromethyl)-1H-indol-3-yl]cyclohexyl]piperazin-1-yl]quinoline.
| Compound Name | 6-methoxy-8-[4-[4-[6-(trifluoromethyl)-1H-indol-3-yl]cyclohexyl]piperazin-1-yl]quinoline |
|---|---|
| PubChem CID | 20701153 |
| Molecular Formula | C29H31F3N4O |
| Molecular Weight | 508.59 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | 6-methoxy-8-[4-[4-[6-(trifluoromethyl)-1H-indol-3-yl]cyclohexyl]piperazin-1-yl]quinoline |
| SMILES | COc1cc(N2CCN(C3CCC(c4c[nH]c5cc(C(F)(F)F)ccc45)CC3)CC2)c2ncccc2c1 |
| InChI | InChI=1S/C29H31F3N4O/c1-37-23-15-20-3-2-10-33-28(20)27(17-23)36-13-11-35(12-14-36)22-7-4-19(5-8-22)25-18-34-26-16-21(29(30,31)32)6-9-24(25)26/h2-3,6,9-10,15-19,22,34H,4-5,7-8,11-14H2,1H3 |
| InChIKey | KPJAMUGMXLKJOG-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.59 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |