C15H21N3O — CID 4908
4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine (PubChem CID 4908) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine.
| Compound Name | 4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 4908 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine |
| SMILES | COc1cc(NC(C)CCCN)c2ncccc2c1 |
| InChI | InChI=1S/C15H21N3O/c1-11(5-3-7-16)18-14-10-13(19-2)9-12-6-4-8-17-15(12)14/h4,6,8-11,18H,3,5,7,16H2,1-2H3 |
| InChIKey | INDBQLZJXZLFIT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |