C12H14BF3N2O2 — CID 20701189
oxo-[[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]piperidin-1-yl]methyl]borane (PubChem CID 20701189) has the molecular formula C12H14BF3N2O2 and a molecular weight of 286.06 g/mol. Its IUPAC name is oxo-[[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]piperidin-1-yl]methyl]borane.
| Compound Name | oxo-[[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]piperidin-1-yl]methyl]borane |
|---|---|
| PubChem CID | 20701189 |
| Molecular Formula | C12H14BF3N2O2 |
| Molecular Weight | 286.06 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | oxo-[[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]piperidin-1-yl]methyl]borane |
| SMILES | O=BCN1CCC(Oc2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C12H14BF3N2O2/c14-12(15,16)9-1-2-11(17-7-9)20-10-3-5-18(6-4-10)8-13-19/h1-2,7,10H,3-6,8H2 |
| InChIKey | OMCJYPJCSRSGSI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.06 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|