C16H13BF3N3O2 — CID 156815214
CID 156815214 (PubChem CID 156815214) has the molecular formula C16H13BF3N3O2 and a molecular weight of 347.11 g/mol.
| Compound Name | CID 156815214 |
|---|---|
| PubChem CID | 156815214 |
| Molecular Formula | C16H13BF3N3O2 |
| Molecular Weight | 347.11 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(N2CCC(Oc3ccc(C(F)(F)F)cn3)C2)c(C=O)n1 |
| InChI | InChI=1S/C16H13BF3N3O2/c17-14-3-2-13(12(9-24)22-14)23-6-5-11(8-23)25-15-4-1-10(7-21-15)16(18,19)20/h1-4,7,9,11H,5-6,8H2 |
| InChIKey | OUASIFIZHYVYNC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.11 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|