C18H19F3N4O2 — CID 166683158
5-(aminomethyl)-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]benzamide (PubChem CID 166683158) has the molecular formula C18H19F3N4O2 and a molecular weight of 380.37 g/mol. Its IUPAC name is 5-(aminomethyl)-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]benzamide.
| Compound Name | 5-(aminomethyl)-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 166683158 |
| Molecular Formula | C18H19F3N4O2 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 5-(aminomethyl)-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]benzamide |
| SMILES | NCc1ccc(N2CCC(Oc3ccc(C(F)(F)F)cn3)C2)c(C(N)=O)c1 |
| InChI | InChI=1S/C18H19F3N4O2/c19-18(20,21)12-2-4-16(24-9-12)27-13-5-6-25(10-13)15-3-1-11(8-22)7-14(15)17(23)26/h1-4,7,9,13H,5-6,8,10,22H2,(H2,23,26) |
| InChIKey | SRTDEKSCFAPLLY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |