C19H16BrF3N2O3 — CID 170313315
(E)-3-[5-bromo-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]phenyl]prop-2-enoic acid (PubChem CID 170313315) has the molecular formula C19H16BrF3N2O3 and a molecular weight of 457.25 g/mol. Its IUPAC name is (E)-3-[5-bromo-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-bromo-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 170313315 |
| Molecular Formula | C19H16BrF3N2O3 |
| Molecular Weight | 457.25 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | (E)-3-[5-bromo-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(Br)ccc1N1CCC(Oc2ccc(C(F)(F)F)cn2)C1 |
| InChI | InChI=1S/C19H16BrF3N2O3/c20-14-3-4-16(12(9-14)1-6-18(26)27)25-8-7-15(11-25)28-17-5-2-13(10-24-17)19(21,22)23/h1-6,9-10,15H,7-8,11H2,(H,26,27)/b6-1+ |
| InChIKey | KWTJQLLKQVISGB-LZCJLJQNSA-N |
| XLogP | 4.62 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.25 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|