About 3-[4-(azetidin-3-yl)-3,5-dimethylphenyl]-5-(2-oxopropylamino)-1,3-oxazolidin-2-one
3-[4-(azetidin-3-yl)-3,5-dimethylphenyl]-5-(2-oxopropylamino)-1,3-oxazolidin-2-one (PubChem CID 20702403) has the molecular formula C17H23N3O3
and a molecular weight of 317.39 g/mol. Its IUPAC name is 3-[4-(azetidin-3-yl)-3,5-dimethylphenyl]-5-(2-oxopropylamino)-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-[4-(azetidin-3-yl)-3,5-dimethylphenyl]-5-(2-oxopropylamino)-1,3-oxazolidin-2-one |
| PubChem CID | 20702403 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 3-[4-(azetidin-3-yl)-3,5-dimethylphenyl]-5-(2-oxopropylamino)-1,3-oxazolidin-2-one |
| SMILES | CC(=O)CNC1CN(c2cc(C)c(C3CNC3)c(C)c2)C(=O)O1 |
| InChI | InChI=1S/C17H23N3O3/c1-10-4-14(5-11(2)16(10)13-7-18-8-13)20-9-15(23-17(20)22)19-6-12(3)21/h4-5,13,15,18-19H,6-9H2,1-3H3 |
| InChIKey | YEQLZUJUJXHCKD-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[4-(azetidin-3-yl)-3,5-dimethylphenyl]-5-(2-oxopropylamino)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(azetidin-3-yl)-3,5-dimethylphenyl]-5-(2-oxopropylamino)-1,3-oxazolidin-2-one?
The IUPAC name of 3-[4-(azetidin-3-yl)-3,5-dimethylphenyl]-5-(2-oxopropylamino)-1,3-oxazolidin-2-one (CID 20702403) is 3-[4-(azetidin-3-yl)-3,5-dimethylphenyl]-5-(2-oxopropylamino)-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-[4-(azetidin-3-yl)-3,5-dimethylphenyl]-5-(2-oxopropylamino)-1,3-oxazolidin-2-one?
The canonical SMILES for 3-[4-(azetidin-3-yl)-3,5-dimethylphenyl]-5-(2-oxopropylamino)-1,3-oxazolidin-2-one is CC(=O)CNC1CN(c2cc(C)c(C3CNC3)c(C)c2)C(=O)O1.
What is the InChIKey of 3-[4-(azetidin-3-yl)-3,5-dimethylphenyl]-5-(2-oxopropylamino)-1,3-oxazolidin-2-one?
The InChIKey is YEQLZUJUJXHCKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O3/c1-10-4-14(5-11(2)16(10)13-7-18-8-13)20-9-15(23-17(20)22)19-6-12(3)21/h4-5,13,15,18-19H,6-9H2,1-3H3.
What are the key properties of 3-[4-(azetidin-3-yl)-3,5-dimethylphenyl]-5-(2-oxopropylamino)-1,3-oxazolidin-2-one?
3-[4-(azetidin-3-yl)-3,5-dimethylphenyl]-5-(2-oxopropylamino)-1,3-oxazolidin-2-one has a molecular weight of 317.39 g/mol, XLogP of 1.45, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(azetidin-3-yl)-3,5-dimethylphenyl]-5-(2-oxopropylamino)-1,3-oxazolidin-2-one is sourced from PubChem (CID 20702403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).