C10H10F2N2O2 — CID 69349331
3-(3,5-difluorophenyl)-5-(methylamino)-1,3-oxazolidin-2-one (PubChem CID 69349331) has the molecular formula C10H10F2N2O2 and a molecular weight of 228.20 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-5-(methylamino)-1,3-oxazolidin-2-one.
| Compound Name | 3-(3,5-difluorophenyl)-5-(methylamino)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 69349331 |
| Molecular Formula | C10H10F2N2O2 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 3-(3,5-difluorophenyl)-5-(methylamino)-1,3-oxazolidin-2-one |
| SMILES | CNC1CN(c2cc(F)cc(F)c2)C(=O)O1 |
| InChI | InChI=1S/C10H10F2N2O2/c1-13-9-5-14(10(15)16-9)8-3-6(11)2-7(12)4-8/h2-4,9,13H,5H2,1H3 |
| InChIKey | SKSYUOQZBYTPKB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |