C7H16N2O2 — CID 144507727
ethane;3-methyl-5-(methylamino)-1,3-oxazolidin-2-one (PubChem CID 144507727) has the molecular formula C7H16N2O2 and a molecular weight of 160.22 g/mol. Its IUPAC name is ethane;3-methyl-5-(methylamino)-1,3-oxazolidin-2-one.
| Compound Name | ethane;3-methyl-5-(methylamino)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 144507727 |
| Molecular Formula | C7H16N2O2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.12 |
| IUPAC Name | ethane;3-methyl-5-(methylamino)-1,3-oxazolidin-2-one |
| SMILES | CC.CNC1CN(C)C(=O)O1 |
| InChI | InChI=1S/C5H10N2O2.C2H6/c1-6-4-3-7(2)5(8)9-4;1-2/h4,6H,3H2,1-2H3;1-2H3 |
| InChIKey | IXTTVJMFOBMODA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |