C43H47N3O14 — CID 20702906
[2-[4-[2,4-bis[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-6-[2-formyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-1,3,5-triazin-2-yl]-5-formylphenyl] tert-butyl carbonate (PubChem CID 20702906) has the molecular formula C43H47N3O14 and a molecular weight of 829.86 g/mol. Its IUPAC name is [2-[4-[2,4-bis[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-6-[2-formyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-1,3,5-triazin-2-yl]-5-formylphenyl] tert-butyl carbonate.
| Compound Name | [2-[4-[2,4-bis[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-6-[2-formyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-1,3,5-triazin-2-yl]-5-formylphenyl] tert-butyl carbonate |
|---|---|
| PubChem CID | 20702906 |
| Molecular Formula | C43H47N3O14 |
| Molecular Weight | 829.86 g/mol |
| Exact Mass | 829.31 |
| IUPAC Name | [2-[4-[2,4-bis[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-6-[2-formyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-1,3,5-triazin-2-yl]-5-formylphenyl] tert-butyl carbonate |
| SMILES | CC(C)(C)OC(=O)Oc1ccc(-c2nc(-c3ccc(C=O)cc3OC(=O)OC(C)(C)C)nc(-c3ccc(OC(=O)OC(C)(C)C)cc3OC(=O)OC(C)(C)C)n2)c(C=O)c1 |
| InChI | InChI=1S/C43H47N3O14/c1-40(2,3)57-36(49)53-26-14-17-28(25(20-26)23-48)33-44-34(29-16-13-24(22-47)19-31(29)55-38(51)59-42(7,8)9)46-35(45-33)30-18-15-27(54-37(50)58-41(4,5)6)21-32(30)56-39(52)60-43(10,11)12/h13-23H,1-12H3 |
| InChIKey | KAEGAKRUGDWLKD-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 214.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.86 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|