C25H31NO6 — CID 144650499
tert-butyl [4-[2-formyl-4-[(2-methyl-4-oxopentan-2-yl)amino]phenyl]-3-methoxyphenyl] carbonate (PubChem CID 144650499) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is tert-butyl [4-[2-formyl-4-[(2-methyl-4-oxopentan-2-yl)amino]phenyl]-3-methoxyphenyl] carbonate.
| Compound Name | tert-butyl [4-[2-formyl-4-[(2-methyl-4-oxopentan-2-yl)amino]phenyl]-3-methoxyphenyl] carbonate |
|---|---|
| PubChem CID | 144650499 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | tert-butyl [4-[2-formyl-4-[(2-methyl-4-oxopentan-2-yl)amino]phenyl]-3-methoxyphenyl] carbonate |
| SMILES | COc1cc(OC(=O)OC(C)(C)C)ccc1-c1ccc(NC(C)(C)CC(C)=O)cc1C=O |
| InChI | InChI=1S/C25H31NO6/c1-16(28)14-25(5,6)26-18-8-10-20(17(12-18)15-27)21-11-9-19(13-22(21)30-7)31-23(29)32-24(2,3)4/h8-13,15,26H,14H2,1-7H3 |
| InChIKey | UZVMXRATZYSMJW-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|