C26H27FN4O3 — CID 20703266
6-fluoro-3'-[3-(4-isocyano-4-phenylpiperidin-1-yl)propyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 20703266) has the molecular formula C26H27FN4O3 and a molecular weight of 462.53 g/mol. Its IUPAC name is 6-fluoro-3'-[3-(4-isocyano-4-phenylpiperidin-1-yl)propyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | 6-fluoro-3'-[3-(4-isocyano-4-phenylpiperidin-1-yl)propyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 20703266 |
| Molecular Formula | C26H27FN4O3 |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 6-fluoro-3'-[3-(4-isocyano-4-phenylpiperidin-1-yl)propyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | [C-]#[N+]C1(c2ccccc2)CCN(CCCN2C(=O)NC3(CCOc4ccc(F)cc43)C2=O)CC1 |
| InChI | InChI=1S/C26H27FN4O3/c1-28-25(19-6-3-2-4-7-19)10-15-30(16-11-25)13-5-14-31-23(32)26(29-24(31)33)12-17-34-22-9-8-20(27)18-21(22)26/h2-4,6-9,18H,5,10-17H2,(H,29,33) |
| InChIKey | NXYGZFBGTIOLNU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|