C30H37NO7 — CID 20704526
[(1R,2S,3S,5S,6R,8S,10E,12R,13S,15R,18S)-18-benzyl-6-hydroxy-6,8,15,16-tetramethyl-7,20-dioxo-4,14-dioxa-19-azapentacyclo[10.8.0.01,17.03,5.013,15]icos-10-en-2-yl] acetate (PubChem CID 20704526) has the molecular formula C30H37NO7 and a molecular weight of 523.63 g/mol. Its IUPAC name is [(1R,2S,3S,5S,6R,8S,10E,12R,13S,15R,18S)-18-benzyl-6-hydroxy-6,8,15,16-tetramethyl-7,20-dioxo-4,14-dioxa-19-azapentacyclo[10.8.0.01,17.03,5.013,15]icos-10-en-2-yl] acetate.
| Compound Name | [(1R,2S,3S,5S,6R,8S,10E,12R,13S,15R,18S)-18-benzyl-6-hydroxy-6,8,15,16-tetramethyl-7,20-dioxo-4,14-dioxa-19-azapentacyclo[10.8.0.01,17.03,5.013,15]icos-10-en-2-yl] acetate |
|---|---|
| PubChem CID | 20704526 |
| Molecular Formula | C30H37NO7 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | [(1R,2S,3S,5S,6R,8S,10E,12R,13S,15R,18S)-18-benzyl-6-hydroxy-6,8,15,16-tetramethyl-7,20-dioxo-4,14-dioxa-19-azapentacyclo[10.8.0.01,17.03,5.013,15]icos-10-en-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]2O[C@@H]2[C@@](C)(O)C(=O)[C@@H](C)C/C=C/[C@H]2[C@@H]3O[C@]3(C)C(C)C3[C@H](Cc4ccccc4)NC(=O)[C@@]312 |
| InChI | InChI=1S/C30H37NO7/c1-15-10-9-13-19-24-29(5,38-24)16(2)21-20(14-18-11-7-6-8-12-18)31-27(34)30(19,21)26(36-17(3)32)22-25(37-22)28(4,35)23(15)33/h6-9,11-13,15-16,19-22,24-26,35H,10,14H2,1-5H3,(H,31,34)/b13-9+/t15-,16?,19-,20-,21?,22+,24-,25-,26+,28-,29+,30-/m0/s1 |
| InChIKey | GSPOYKSHFNFUKI-SDCSSJTGSA-N |
| XLogP | 2.37 |
| TPSA | 117.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|