C13H24N2O8 — CID 20705967
N-[(2R,3R,4S,6S)-4,6-dihydroxy-6-[(2-oxoethylamino)methyl]-2-[(1R,2R)-1,2,3-trihydroxypropyl]oxan-3-yl]acetamide (PubChem CID 20705967) has the molecular formula C13H24N2O8 and a molecular weight of 336.34 g/mol. Its IUPAC name is N-[(2R,3R,4S,6S)-4,6-dihydroxy-6-[(2-oxoethylamino)methyl]-2-[(1R,2R)-1,2,3-trihydroxypropyl]oxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4S,6S)-4,6-dihydroxy-6-[(2-oxoethylamino)methyl]-2-[(1R,2R)-1,2,3-trihydroxypropyl]oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 20705967 |
| Molecular Formula | C13H24N2O8 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | N-[(2R,3R,4S,6S)-4,6-dihydroxy-6-[(2-oxoethylamino)methyl]-2-[(1R,2R)-1,2,3-trihydroxypropyl]oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)O[C@](O)(CNCC=O)C[C@@H]1O |
| InChI | InChI=1S/C13H24N2O8/c1-7(18)15-10-8(19)4-13(22,6-14-2-3-16)23-12(10)11(21)9(20)5-17/h3,8-12,14,17,19-22H,2,4-6H2,1H3,(H,15,18)/t8-,9+,10+,11+,12+,13-/m0/s1 |
| InChIKey | SISPDPAUDHCRRF-TXWLSFLZSA-N |
| XLogP | -4.17 |
| TPSA | 168.58 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | -4.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|