C17H16F2N2O2 — CID 20706449
N'-[(3,5-dimethylphenyl)methyl]-2,2-difluoro-1,3-benzodioxole-5-carboximidamide (PubChem CID 20706449) has the molecular formula C17H16F2N2O2 and a molecular weight of 318.32 g/mol. Its IUPAC name is N'-[(3,5-dimethylphenyl)methyl]-2,2-difluoro-1,3-benzodioxole-5-carboximidamide.
| Compound Name | N'-[(3,5-dimethylphenyl)methyl]-2,2-difluoro-1,3-benzodioxole-5-carboximidamide |
|---|---|
| PubChem CID | 20706449 |
| Molecular Formula | C17H16F2N2O2 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N'-[(3,5-dimethylphenyl)methyl]-2,2-difluoro-1,3-benzodioxole-5-carboximidamide |
| SMILES | Cc1cc(C)cc(C/N=C(\N)c2ccc3c(c2)OC(F)(F)O3)c1 |
| InChI | InChI=1S/C17H16F2N2O2/c1-10-5-11(2)7-12(6-10)9-21-16(20)13-3-4-14-15(8-13)23-17(18,19)22-14/h3-8H,9H2,1-2H3,(H2,20,21) |
| InChIKey | OYPUVABMWYZDMU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|