C9H11N3O2 — CID 28410
2-(1,3-benzodioxol-5-ylmethyl)guanidine (PubChem CID 28410) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)guanidine.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)guanidine |
|---|---|
| PubChem CID | 28410 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)guanidine |
| SMILES | NC(N)=NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H11N3O2/c10-9(11)12-4-6-1-2-7-8(3-6)14-5-13-7/h1-3H,4-5H2,(H4,10,11,12) |
| InChIKey | QVBNBQQABMECQB-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|