C12H26N2O — CID 20706491
1,1-dimethyl-3-(3,3,4,4-tetramethylpentyl)urea (PubChem CID 20706491) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is 1,1-dimethyl-3-(3,3,4,4-tetramethylpentyl)urea.
| Compound Name | 1,1-dimethyl-3-(3,3,4,4-tetramethylpentyl)urea |
|---|---|
| PubChem CID | 20706491 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 1,1-dimethyl-3-(3,3,4,4-tetramethylpentyl)urea |
| SMILES | CN(C)C(=O)NCCC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H26N2O/c1-11(2,3)12(4,5)8-9-13-10(15)14(6)7/h8-9H2,1-7H3,(H,13,15) |
| InChIKey | ADLKCLWNLBLRKC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |