C14H30N2O — CID 20706494
1,1-dimethyl-3-(5,5,6,6-tetramethylheptyl)urea (PubChem CID 20706494) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is 1,1-dimethyl-3-(5,5,6,6-tetramethylheptyl)urea.
| Compound Name | 1,1-dimethyl-3-(5,5,6,6-tetramethylheptyl)urea |
|---|---|
| PubChem CID | 20706494 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | 1,1-dimethyl-3-(5,5,6,6-tetramethylheptyl)urea |
| SMILES | CN(C)C(=O)NCCCCC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H30N2O/c1-13(2,3)14(4,5)10-8-9-11-15-12(17)16(6)7/h8-11H2,1-7H3,(H,15,17) |
| InChIKey | AWTNAFGEZOZWDE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|