C10H24N2O2S — CID 20706577
3,3,4,4-tetramethyl-N-(methylsulfamoyl)pentan-1-amine (PubChem CID 20706577) has the molecular formula C10H24N2O2S and a molecular weight of 236.38 g/mol. Its IUPAC name is 3,3,4,4-tetramethyl-N-(methylsulfamoyl)pentan-1-amine.
| Compound Name | 3,3,4,4-tetramethyl-N-(methylsulfamoyl)pentan-1-amine |
|---|---|
| PubChem CID | 20706577 |
| Molecular Formula | C10H24N2O2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 3,3,4,4-tetramethyl-N-(methylsulfamoyl)pentan-1-amine |
| SMILES | CNS(=O)(=O)NCCC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C10H24N2O2S/c1-9(2,3)10(4,5)7-8-12-15(13,14)11-6/h11-12H,7-8H2,1-6H3 |
| InChIKey | SZGKBCMMJZNDJC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |