C22H32N2 — CID 20706847
2,6-ditert-butyl-4-methyl-N-(1-pyridin-2-ylethyl)aniline (PubChem CID 20706847) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-methyl-N-(1-pyridin-2-ylethyl)aniline.
| Compound Name | 2,6-ditert-butyl-4-methyl-N-(1-pyridin-2-ylethyl)aniline |
|---|---|
| PubChem CID | 20706847 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | 2,6-ditert-butyl-4-methyl-N-(1-pyridin-2-ylethyl)aniline |
| SMILES | Cc1cc(C(C)(C)C)c(NC(C)c2ccccn2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H32N2/c1-15-13-17(21(3,4)5)20(18(14-15)22(6,7)8)24-16(2)19-11-9-10-12-23-19/h9-14,16,24H,1-8H3 |
| InChIKey | PSOOPHOFQKWADT-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |