C26H33N3O4S — CID 20707830
3-pyridin-3-ylpropyl 12-(3,3-dimethyl-2-oxopentanoyl)-4-thia-1,12-diazatricyclo[7.4.0.03,7]trideca-3(7),5-diene-11-carboxylate (PubChem CID 20707830) has the molecular formula C26H33N3O4S and a molecular weight of 483.63 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl 12-(3,3-dimethyl-2-oxopentanoyl)-4-thia-1,12-diazatricyclo[7.4.0.03,7]trideca-3(7),5-diene-11-carboxylate.
| Compound Name | 3-pyridin-3-ylpropyl 12-(3,3-dimethyl-2-oxopentanoyl)-4-thia-1,12-diazatricyclo[7.4.0.03,7]trideca-3(7),5-diene-11-carboxylate |
|---|---|
| PubChem CID | 20707830 |
| Molecular Formula | C26H33N3O4S |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 3-pyridin-3-ylpropyl 12-(3,3-dimethyl-2-oxopentanoyl)-4-thia-1,12-diazatricyclo[7.4.0.03,7]trideca-3(7),5-diene-11-carboxylate |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CN2Cc3sccc3CC2CC1C(=O)OCCCc1cccnc1 |
| InChI | InChI=1S/C26H33N3O4S/c1-4-26(2,3)23(30)24(31)29-17-28-16-22-19(9-12-34-22)13-20(28)14-21(29)25(32)33-11-6-8-18-7-5-10-27-15-18/h5,7,9-10,12,15,20-21H,4,6,8,11,13-14,16-17H2,1-3H3 |
| InChIKey | BTOKUOOGOIOCRP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|