C32H32N4O3 — CID 20708104
methyl 2-[(3-carbamimidoylphenyl)methyl]-5-phenyl-3-[(4-pyridin-3-ylbenzoyl)amino]pentanoate (PubChem CID 20708104) has the molecular formula C32H32N4O3 and a molecular weight of 520.63 g/mol. Its IUPAC name is methyl 2-[(3-carbamimidoylphenyl)methyl]-5-phenyl-3-[(4-pyridin-3-ylbenzoyl)amino]pentanoate.
| Compound Name | methyl 2-[(3-carbamimidoylphenyl)methyl]-5-phenyl-3-[(4-pyridin-3-ylbenzoyl)amino]pentanoate |
|---|---|
| PubChem CID | 20708104 |
| Molecular Formula | C32H32N4O3 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | methyl 2-[(3-carbamimidoylphenyl)methyl]-5-phenyl-3-[(4-pyridin-3-ylbenzoyl)amino]pentanoate |
| SMILES | [H]/N=C(\N)c1cccc(CC(C(=O)OC)C(CCc2ccccc2)NC(=O)c2ccc(-c3cccnc3)cc2)c1 |
| InChI | InChI=1S/C32H32N4O3/c1-39-32(38)28(20-23-9-5-10-26(19-23)30(33)34)29(17-12-22-7-3-2-4-8-22)36-31(37)25-15-13-24(14-16-25)27-11-6-18-35-21-27/h2-11,13-16,18-19,21,28-29H,12,17,20H2,1H3,(H3,33,34)(H,36,37) |
| InChIKey | YPIFKWAQEOBLFP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 118.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|