C7H13N — CID 20709743
2,3,5-trimethyl-2,3-dihydro-1H-pyrrole (PubChem CID 20709743) has the molecular formula C7H13N and a molecular weight of 111.19 g/mol. Its IUPAC name is 2,3,5-trimethyl-2,3-dihydro-1H-pyrrole.
| Compound Name | 2,3,5-trimethyl-2,3-dihydro-1H-pyrrole |
|---|---|
| PubChem CID | 20709743 |
| Molecular Formula | C7H13N |
| Molecular Weight | 111.19 g/mol |
| Exact Mass | 111.10 |
| IUPAC Name | 2,3,5-trimethyl-2,3-dihydro-1H-pyrrole |
| SMILES | CC1=CC(C)C(C)N1 |
| InChI | InChI=1S/C7H13N/c1-5-4-6(2)8-7(5)3/h4-5,7-8H,1-3H3 |
| InChIKey | ORALGMAFRVFOBJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.19 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |