C21H18O — CID 20709961
4-[bis(4-methylphenyl)methylidene]cyclohexa-2,5-dien-1-one (PubChem CID 20709961) has the molecular formula C21H18O and a molecular weight of 286.37 g/mol. Its IUPAC name is 4-[bis(4-methylphenyl)methylidene]cyclohexa-2,5-dien-1-one.
| Compound Name | 4-[bis(4-methylphenyl)methylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 20709961 |
| Molecular Formula | C21H18O |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 4-[bis(4-methylphenyl)methylidene]cyclohexa-2,5-dien-1-one |
| SMILES | Cc1ccc(C(=C2C=CC(=O)C=C2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H18O/c1-15-3-7-17(8-4-15)21(18-9-5-16(2)6-10-18)19-11-13-20(22)14-12-19/h3-14H,1-2H3 |
| InChIKey | VLWMAYSADNNYIW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |