methyl 2,2,3,4,5-pentamethyl-5-piperidin-1-ylhexanoate

C17H33NO2 — CID 20714215

IUPACmethyl 2,2,3,4,5-pentamethyl-5-piperidin-1-ylhexanoate
SMILESCOC(=O)C(C)(C)C(C)C(C)C(C)(C)N1CCCCC1
InChIInChI=1S/C17H33NO2/c1-13(16(3,4)15(19)20-7)14(2)17(5,6)18-11-9-8-10-12-18/h13-14H,8-12H2,1-7H3
InChIKeyPOJKABNSOVLRJC-UHFFFAOYSA-N
MW283.46 g/mol
LogP3.72
Rot. Bonds5

About methyl 2,2,3,4,5-pentamethyl-5-piperidin-1-ylhexanoate

methyl 2,2,3,4,5-pentamethyl-5-piperidin-1-ylhexanoate (PubChem CID 20714215) has the molecular formula C17H33NO2 and a molecular weight of 283.46 g/mol. Its IUPAC name is methyl 2,2,3,4,5-pentamethyl-5-piperidin-1-ylhexanoate.

Molecular Properties

Compound Namemethyl 2,2,3,4,5-pentamethyl-5-piperidin-1-ylhexanoate
PubChem CID20714215
Molecular FormulaC17H33NO2
Molecular Weight283.46 g/mol
Exact Mass283.25
IUPAC Namemethyl 2,2,3,4,5-pentamethyl-5-piperidin-1-ylhexanoate
SMILESCOC(=O)C(C)(C)C(C)C(C)C(C)(C)N1CCCCC1
InChIInChI=1S/C17H33NO2/c1-13(16(3,4)15(19)20-7)14(2)17(5,6)18-11-9-8-10-12-18/h13-14H,8-12H2,1-7H3
InChIKeyPOJKABNSOVLRJC-UHFFFAOYSA-N
XLogP3.72
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.46
LogP ≤ 53.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2,2,3,4,5-pentamethyl-5-piperidin-1-ylhexanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,2,3,4,5-pentamethyl-5-piperidin-1-ylhexanoate?
The IUPAC name of methyl 2,2,3,4,5-pentamethyl-5-piperidin-1-ylhexanoate (CID 20714215) is methyl 2,2,3,4,5-pentamethyl-5-piperidin-1-ylhexanoate.
What is the SMILES notation for methyl 2,2,3,4,5-pentamethyl-5-piperidin-1-ylhexanoate?
The canonical SMILES for methyl 2,2,3,4,5-pentamethyl-5-piperidin-1-ylhexanoate is COC(=O)C(C)(C)C(C)C(C)C(C)(C)N1CCCCC1.
What is the InChIKey of methyl 2,2,3,4,5-pentamethyl-5-piperidin-1-ylhexanoate?
The InChIKey is POJKABNSOVLRJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33NO2/c1-13(16(3,4)15(19)20-7)14(2)17(5,6)18-11-9-8-10-12-18/h13-14H,8-12H2,1-7H3.
What are the key properties of methyl 2,2,3,4,5-pentamethyl-5-piperidin-1-ylhexanoate?
methyl 2,2,3,4,5-pentamethyl-5-piperidin-1-ylhexanoate has a molecular weight of 283.46 g/mol, XLogP of 3.72, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,2,3,4,5-pentamethyl-5-piperidin-1-ylhexanoate is sourced from PubChem (CID 20714215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).