C17H33NO2 — CID 20714215
methyl 2,2,3,4,5-pentamethyl-5-piperidin-1-ylhexanoate (PubChem CID 20714215) has the molecular formula C17H33NO2 and a molecular weight of 283.46 g/mol. Its IUPAC name is methyl 2,2,3,4,5-pentamethyl-5-piperidin-1-ylhexanoate.
| Compound Name | methyl 2,2,3,4,5-pentamethyl-5-piperidin-1-ylhexanoate |
|---|---|
| PubChem CID | 20714215 |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | methyl 2,2,3,4,5-pentamethyl-5-piperidin-1-ylhexanoate |
| SMILES | COC(=O)C(C)(C)C(C)C(C)C(C)(C)N1CCCCC1 |
| InChI | InChI=1S/C17H33NO2/c1-13(16(3,4)15(19)20-7)14(2)17(5,6)18-11-9-8-10-12-18/h13-14H,8-12H2,1-7H3 |
| InChIKey | POJKABNSOVLRJC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |