C14H22O8S4-2 — CID 20714821
1-(2-butylsulfanylethylsulfonyl)-4-[2-(hydroxy-oxido-oxo-sulfonato-λ6-sulfanyl)ethyl]benzene (PubChem CID 20714821) has the molecular formula C14H22O8S4-2 and a molecular weight of 446.59 g/mol. Its IUPAC name is 1-(2-butylsulfanylethylsulfonyl)-4-[2-(hydroxy-oxido-oxo-sulfonato-λ6-sulfanyl)ethyl]benzene.
| Compound Name | 1-(2-butylsulfanylethylsulfonyl)-4-[2-(hydroxy-oxido-oxo-sulfonato-λ6-sulfanyl)ethyl]benzene |
|---|---|
| PubChem CID | 20714821 |
| Molecular Formula | C14H22O8S4-2 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | 1-(2-butylsulfanylethylsulfonyl)-4-[2-(hydroxy-oxido-oxo-sulfonato-λ6-sulfanyl)ethyl]benzene |
| SMILES | CCCCSCCS(=O)(=O)c1ccc(CCS(=O)([O-])(O)S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C14H24O8S4/c1-2-3-9-23-10-11-24(15,16)14-6-4-13(5-7-14)8-12-26(20,21,22)25(17,18)19/h4-7H,2-3,8-12H2,1H3,(H,17,18,19)(H2,20,21,22)/p-2 |
| InChIKey | GCOGTJVZCKRTJB-UHFFFAOYSA-L |
| XLogP | 1.42 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|