C15H22N2O4 — CID 20715419
2-hydroxy-3-nitro-N-(2,4,4-trimethylpentan-2-yl)benzamide (PubChem CID 20715419) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-hydroxy-3-nitro-N-(2,4,4-trimethylpentan-2-yl)benzamide.
| Compound Name | 2-hydroxy-3-nitro-N-(2,4,4-trimethylpentan-2-yl)benzamide |
|---|---|
| PubChem CID | 20715419 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-hydroxy-3-nitro-N-(2,4,4-trimethylpentan-2-yl)benzamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)c1cccc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C15H22N2O4/c1-14(2,3)9-15(4,5)16-13(19)10-7-6-8-11(12(10)18)17(20)21/h6-8,18H,9H2,1-5H3,(H,16,19) |
| InChIKey | KPZAEHBRMXFVON-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|