C14H19N3O7 — CID 99794751
N'-(2,2-diethoxypropanoyl)-2-hydroxy-3-nitrobenzohydrazide (PubChem CID 99794751) has the molecular formula C14H19N3O7 and a molecular weight of 341.32 g/mol. Its IUPAC name is N'-(2,2-diethoxypropanoyl)-2-hydroxy-3-nitrobenzohydrazide.
| Compound Name | N'-(2,2-diethoxypropanoyl)-2-hydroxy-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 99794751 |
| Molecular Formula | C14H19N3O7 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N'-(2,2-diethoxypropanoyl)-2-hydroxy-3-nitrobenzohydrazide |
| SMILES | CCOC(C)(OCC)C(=O)NNC(=O)c1cccc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C14H19N3O7/c1-4-23-14(3,24-5-2)13(20)16-15-12(19)9-7-6-8-10(11(9)18)17(21)22/h6-8,18H,4-5H2,1-3H3,(H,15,19)(H,16,20) |
| InChIKey | GTPMGZJLKAPFBY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|