C4H11NOP2 — CID 20718052
1-(oxiran-2-yl)-N,N-bis(phosphanyl)ethanamine (PubChem CID 20718052) has the molecular formula C4H11NOP2 and a molecular weight of 151.09 g/mol. Its IUPAC name is 1-(oxiran-2-yl)-N,N-bis(phosphanyl)ethanamine.
| Compound Name | 1-(oxiran-2-yl)-N,N-bis(phosphanyl)ethanamine |
|---|---|
| PubChem CID | 20718052 |
| Molecular Formula | C4H11NOP2 |
| Molecular Weight | 151.09 g/mol |
| Exact Mass | 151.03 |
| IUPAC Name | 1-(oxiran-2-yl)-N,N-bis(phosphanyl)ethanamine |
| SMILES | CC(C1CO1)N(P)P |
| InChI | InChI=1S/C4H11NOP2/c1-3(5(7)8)4-2-6-4/h3-4H,2,7-8H2,1H3 |
| InChIKey | UOQTVTHFWNICOO-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 15.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.09 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|