C28H30O4 — CID 20724292
(4-cyclohexyloxycarbonylcyclohexyl) 4-(2-phenylethynyl)benzoate (PubChem CID 20724292) has the molecular formula C28H30O4 and a molecular weight of 430.54 g/mol. Its IUPAC name is (4-cyclohexyloxycarbonylcyclohexyl) 4-(2-phenylethynyl)benzoate.
| Compound Name | (4-cyclohexyloxycarbonylcyclohexyl) 4-(2-phenylethynyl)benzoate |
|---|---|
| PubChem CID | 20724292 |
| Molecular Formula | C28H30O4 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | (4-cyclohexyloxycarbonylcyclohexyl) 4-(2-phenylethynyl)benzoate |
| SMILES | O=C(OC1CCC(C(=O)OC2CCCCC2)CC1)c1ccc(C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C28H30O4/c29-27(23-15-13-22(14-16-23)12-11-21-7-3-1-4-8-21)32-26-19-17-24(18-20-26)28(30)31-25-9-5-2-6-10-25/h1,3-4,7-8,13-16,24-26H,2,5-6,9-10,17-20H2 |
| InChIKey | KICGOKNEDNGXQD-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|