C28H26O4 — CID 20724299
[4-(cyclohexyloxymethoxy)phenyl] 4-(2-phenylethynyl)benzoate (PubChem CID 20724299) has the molecular formula C28H26O4 and a molecular weight of 426.51 g/mol. Its IUPAC name is [4-(cyclohexyloxymethoxy)phenyl] 4-(2-phenylethynyl)benzoate.
| Compound Name | [4-(cyclohexyloxymethoxy)phenyl] 4-(2-phenylethynyl)benzoate |
|---|---|
| PubChem CID | 20724299 |
| Molecular Formula | C28H26O4 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | [4-(cyclohexyloxymethoxy)phenyl] 4-(2-phenylethynyl)benzoate |
| SMILES | O=C(Oc1ccc(OCOC2CCCCC2)cc1)c1ccc(C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C28H26O4/c29-28(24-15-13-23(14-16-24)12-11-22-7-3-1-4-8-22)32-27-19-17-26(18-20-27)31-21-30-25-9-5-2-6-10-25/h1,3-4,7-8,13-20,25H,2,5-6,9-10,21H2 |
| InChIKey | VMJASJGVZPMAEU-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|