C30H18O4 — CID 19869999
phenyl 4-[4-(4-phenoxycarbonylphenyl)buta-1,3-diynyl]benzoate (PubChem CID 19869999) has the molecular formula C30H18O4 and a molecular weight of 442.47 g/mol. Its IUPAC name is phenyl 4-[4-(4-phenoxycarbonylphenyl)buta-1,3-diynyl]benzoate.
| Compound Name | phenyl 4-[4-(4-phenoxycarbonylphenyl)buta-1,3-diynyl]benzoate |
|---|---|
| PubChem CID | 19869999 |
| Molecular Formula | C30H18O4 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | phenyl 4-[4-(4-phenoxycarbonylphenyl)buta-1,3-diynyl]benzoate |
| SMILES | O=C(Oc1ccccc1)c1ccc(C#CC#Cc2ccc(C(=O)Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H18O4/c31-29(33-27-11-3-1-4-12-27)25-19-15-23(16-20-25)9-7-8-10-24-17-21-26(22-18-24)30(32)34-28-13-5-2-6-14-28/h1-6,11-22H |
| InChIKey | KDOYUKQTYTVFLE-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|